C5H7F3O — CID 87855632
3-(1,2,2-trifluoroethoxy)prop-1-ene (PubChem CID 87855632) has the molecular formula C5H7F3O and a molecular weight of 140.10 g/mol. Its IUPAC name is 3-(1,2,2-trifluoroethoxy)prop-1-ene.
| Compound Name | 3-(1,2,2-trifluoroethoxy)prop-1-ene |
|---|---|
| PubChem CID | 87855632 |
| Molecular Formula | C5H7F3O |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 3-(1,2,2-trifluoroethoxy)prop-1-ene |
| SMILES | C=CCOC(F)C(F)F |
| InChI | InChI=1S/C5H7F3O/c1-2-3-9-5(8)4(6)7/h2,4-5H,1,3H2 |
| InChIKey | CNLLIGSENHSRPF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|