C20H25N3O8S — CID 87855644
(2S)-1-[(2S,5S)-5-amino-2-methyl-7-[4-(nitrooxymethyl)phenyl]-4,7-dioxo-3-sulfanylheptanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 87855644) has the molecular formula C20H25N3O8S and a molecular weight of 467.50 g/mol. Its IUPAC name is (2S)-1-[(2S,5S)-5-amino-2-methyl-7-[4-(nitrooxymethyl)phenyl]-4,7-dioxo-3-sulfanylheptanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S,5S)-5-amino-2-methyl-7-[4-(nitrooxymethyl)phenyl]-4,7-dioxo-3-sulfanylheptanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87855644 |
| Molecular Formula | C20H25N3O8S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (2S)-1-[(2S,5S)-5-amino-2-methyl-7-[4-(nitrooxymethyl)phenyl]-4,7-dioxo-3-sulfanylheptanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)C(S)C(=O)[C@@H](N)CC(=O)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H25N3O8S/c1-11(19(26)22-8-2-3-15(22)20(27)28)18(32)17(25)14(21)9-16(24)13-6-4-12(5-7-13)10-31-23(29)30/h4-7,11,14-15,18,32H,2-3,8-10,21H2,1H3,(H,27,28)/t11-,14+,15+,18?/m1/s1 |
| InChIKey | ADMTZBPSDHRCHS-QKJLKCBVSA-N |
| XLogP | 0.87 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|