C16H19ClF3NO2 — CID 87855997
4-[2-(phenylmethoxyamino)ethyl]-1-(trifluoromethyl)cyclohexa-2,4-dien-1-ol;hydrochloride (PubChem CID 87855997) has the molecular formula C16H19ClF3NO2 and a molecular weight of 349.78 g/mol. Its IUPAC name is 4-[2-(phenylmethoxyamino)ethyl]-1-(trifluoromethyl)cyclohexa-2,4-dien-1-ol;hydrochloride.
| Compound Name | 4-[2-(phenylmethoxyamino)ethyl]-1-(trifluoromethyl)cyclohexa-2,4-dien-1-ol;hydrochloride |
|---|---|
| PubChem CID | 87855997 |
| Molecular Formula | C16H19ClF3NO2 |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-[2-(phenylmethoxyamino)ethyl]-1-(trifluoromethyl)cyclohexa-2,4-dien-1-ol;hydrochloride |
| SMILES | Cl.OC1(C(F)(F)F)C=CC(CCNOCc2ccccc2)=CC1 |
| InChI | InChI=1S/C16H18F3NO2.ClH/c17-16(18,19)15(21)9-6-13(7-10-15)8-11-20-22-12-14-4-2-1-3-5-14;/h1-7,9,20-21H,8,10-12H2;1H |
| InChIKey | PUOMERHSICCKFE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|