C23H34O2S — CID 87856951
(4Z,7Z,10Z,13Z,16Z,19Z)-2-methylsulfinyldocosa-4,7,10,13,16,19-hexaenal (PubChem CID 87856951) has the molecular formula C23H34O2S and a molecular weight of 374.59 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-2-methylsulfinyldocosa-4,7,10,13,16,19-hexaenal.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-2-methylsulfinyldocosa-4,7,10,13,16,19-hexaenal |
|---|---|
| PubChem CID | 87856951 |
| Molecular Formula | C23H34O2S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-2-methylsulfinyldocosa-4,7,10,13,16,19-hexaenal |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(C=O)S(C)=O |
| InChI | InChI=1S/C23H34O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(22-24)26(2)25/h4-5,7-8,10-11,13-14,16-17,19-20,22-23H,3,6,9,12,15,18,21H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | NBVVKDIVDMMDIH-JDPCYWKWSA-N |
| XLogP | 6.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|