C11H19NO — CID 88787367
(4E,8E)-2-aminoundeca-4,8-dienal (PubChem CID 88787367) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4E,8E)-2-aminoundeca-4,8-dienal.
| Compound Name | (4E,8E)-2-aminoundeca-4,8-dienal |
|---|---|
| PubChem CID | 88787367 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4E,8E)-2-aminoundeca-4,8-dienal |
| SMILES | CC/C=C/CC/C=C/CC(N)C=O |
| InChI | InChI=1S/C11H19NO/c1-2-3-4-5-6-7-8-9-11(12)10-13/h3-4,7-8,10-11H,2,5-6,9,12H2,1H3/b4-3+,8-7+ |
| InChIKey | ZNGINHRMPGIBGU-DYWGDJMRSA-N |
| XLogP | 2.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|