2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid

C10H12O6 — CID 87859670

IUPAC2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid
SMILESCOc1c(C)c(C(=O)O)c(O)c(O)c1OC
InChIInChI=1S/C10H12O6/c1-4-5(10(13)14)6(11)7(12)9(16-3)8(4)15-2/h11-12H,1-3H3,(H,13,14)
InChIKeyKEKDSUKUEDDTHT-UHFFFAOYSA-N
MW228.20 g/mol
LogP1.12
Rot. Bonds3

About 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid

2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid (PubChem CID 87859670) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid.

Molecular Properties

Compound Name2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid
PubChem CID87859670
Molecular FormulaC10H12O6
Molecular Weight228.20 g/mol
Exact Mass228.06
IUPAC Name2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid
SMILESCOc1c(C)c(C(=O)O)c(O)c(O)c1OC
InChIInChI=1S/C10H12O6/c1-4-5(10(13)14)6(11)7(12)9(16-3)8(4)15-2/h11-12H,1-3H3,(H,13,14)
InChIKeyKEKDSUKUEDDTHT-UHFFFAOYSA-N
XLogP1.12
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.20
LogP ≤ 51.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid?
The IUPAC name of 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid (CID 87859670) is 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid.
What is the SMILES notation for 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid?
The canonical SMILES for 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid is COc1c(C)c(C(=O)O)c(O)c(O)c1OC.
What is the InChIKey of 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid?
The InChIKey is KEKDSUKUEDDTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6/c1-4-5(10(13)14)6(11)7(12)9(16-3)8(4)15-2/h11-12H,1-3H3,(H,13,14).
What are the key properties of 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid?
2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid has a molecular weight of 228.20 g/mol, XLogP of 1.12, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid is sourced from PubChem (CID 87859670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).