C10H12O6 — CID 87859670
2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid (PubChem CID 87859670) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid.
| Compound Name | 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid |
|---|---|
| PubChem CID | 87859670 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2,3-dihydroxy-4,5-dimethoxy-6-methylbenzoic acid |
| SMILES | COc1c(C)c(C(=O)O)c(O)c(O)c1OC |
| InChI | InChI=1S/C10H12O6/c1-4-5(10(13)14)6(11)7(12)9(16-3)8(4)15-2/h11-12H,1-3H3,(H,13,14) |
| InChIKey | KEKDSUKUEDDTHT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|