About CID 87866279
CID 87866279 (PubChem CID 87866279) has the molecular formula C34H26Cl2F6SiZr
and a molecular weight of 738.79 g/mol.
Molecular Properties
| Compound Name | CID 87866279 |
| PubChem CID | 87866279 |
| Molecular Formula | C34H26Cl2F6SiZr |
| Molecular Weight | 738.79 g/mol |
| Exact Mass | 736.01 |
| IUPAC Name | — |
| SMILES | CCc1ccc2[cH-]c(C(C)C)cc2c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2 |
| InChI | InChI=1S/C22H19F6.C12H7Si.2ClH.Zr/c1-4-13-5-6-14-7-15(12(2)3)10-19(14)20(13)16-8-17(21(23,24)25)11-18(9-16)22(26,27)28;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h5-12H,4H2,1-3H3;1-7H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | OMFFZFCFFWHKAG-UHFFFAOYSA-L |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.79 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87866279 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87866279?
The IUPAC name of CID 87866279 (CID 87866279) is not available.
What is the SMILES notation for CID 87866279?
The canonical SMILES for CID 87866279 is CCc1ccc2[cH-]c(C(C)C)cc2c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2.
What is the InChIKey of CID 87866279?
The InChIKey is OMFFZFCFFWHKAG-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H19F6.C12H7Si.2ClH.Zr/c1-4-13-5-6-14-7-15(12(2)3)10-19(14)20(13)16-8-17(21(23,24)25)11-18(9-16)22(26,27)28;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h5-12H,4H2,1-3H3;1-7H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of CID 87866279?
CID 87866279 has a molecular weight of 738.79 g/mol, XLogP of 10.45, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87866279 is sourced from PubChem (CID 87866279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).