About CID 87866378
CID 87866378 (PubChem CID 87866378) has the molecular formula C36H30Cl2F6SiZr
and a molecular weight of 766.84 g/mol.
Molecular Properties
| Compound Name | CID 87866378 |
| PubChem CID | 87866378 |
| Molecular Formula | C36H30Cl2F6SiZr |
| Molecular Weight | 766.84 g/mol |
| Exact Mass | 764.04 |
| IUPAC Name | — |
| SMILES | CCCc1ccc2[cH-]c(C(C)CC)cc2c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2 |
| InChI | InChI=1S/C24H23F6.C12H7Si.2ClH.Zr/c1-4-6-15-7-8-16-9-17(14(3)5-2)12-21(16)22(15)18-10-19(23(25,26)27)13-20(11-18)24(28,29)30;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h7-14H,4-6H2,1-3H3;1-7H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | FURFJIPJLGTQSJ-UHFFFAOYSA-L |
| XLogP | 11.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 766.84 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87866378 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87866378?
The IUPAC name of CID 87866378 (CID 87866378) is not available.
What is the SMILES notation for CID 87866378?
The canonical SMILES for CID 87866378 is CCCc1ccc2[cH-]c(C(C)CC)cc2c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2.
What is the InChIKey of CID 87866378?
The InChIKey is FURFJIPJLGTQSJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H23F6.C12H7Si.2ClH.Zr/c1-4-6-15-7-8-16-9-17(14(3)5-2)12-21(16)22(15)18-10-19(23(25,26)27)13-20(11-18)24(28,29)30;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h7-14H,4-6H2,1-3H3;1-7H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of CID 87866378?
CID 87866378 has a molecular weight of 766.84 g/mol, XLogP of 11.23, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87866378 is sourced from PubChem (CID 87866378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).