About CID 87866396
CID 87866396 (PubChem CID 87866396) has the molecular formula C36H36Cl2SiZr
and a molecular weight of 658.90 g/mol.
Molecular Properties
| Compound Name | CID 87866396 |
| PubChem CID | 87866396 |
| Molecular Formula | C36H36Cl2SiZr |
| Molecular Weight | 658.90 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | — |
| SMILES | CCCc1ccc2[cH-]c(C(C)CC)cc2c1-c1cc(C)cc(C)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2 |
| InChI | InChI=1S/C24H29.C12H7Si.2ClH.Zr/c1-6-8-19-9-10-20-14-21(18(5)7-2)15-23(20)24(19)22-12-16(3)11-17(4)13-22;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h9-15,18H,6-8H2,1-5H3;1-7H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | IZMVIUGPXZEZIY-UHFFFAOYSA-L |
| XLogP | 9.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 658.90 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87866396 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87866396?
The IUPAC name of CID 87866396 (CID 87866396) is not available.
What is the SMILES notation for CID 87866396?
The canonical SMILES for CID 87866396 is CCCc1ccc2[cH-]c(C(C)CC)cc2c1-c1cc(C)cc(C)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2.
What is the InChIKey of CID 87866396?
The InChIKey is IZMVIUGPXZEZIY-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H29.C12H7Si.2ClH.Zr/c1-6-8-19-9-10-20-14-21(18(5)7-2)15-23(20)24(19)22-12-16(3)11-17(4)13-22;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h9-15,18H,6-8H2,1-5H3;1-7H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of CID 87866396?
CID 87866396 has a molecular weight of 658.90 g/mol, XLogP of 9.81, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87866396 is sourced from PubChem (CID 87866396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).