C36H36Cl2SiZr — CID 87866396
CID 87866396 (PubChem CID 87866396) has the molecular formula C36H36Cl2SiZr and a molecular weight of 658.90 g/mol.
| Compound Name | CID 87866396 |
|---|---|
| PubChem CID | 87866396 |
| Molecular Formula | C36H36Cl2SiZr |
| Molecular Weight | 658.90 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | — |
| SMILES | CCCc1ccc2[cH-]c(C(C)CC)cc2c1-c1cc(C)cc(C)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2 |
| InChI | InChI=1S/C24H29.C12H7Si.2ClH.Zr/c1-6-8-19-9-10-20-14-21(18(5)7-2)15-23(20)24(19)22-12-16(3)11-17(4)13-22;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h9-15,18H,6-8H2,1-5H3;1-7H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | IZMVIUGPXZEZIY-UHFFFAOYSA-L |
| XLogP | 9.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.90 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|