C19H21ClF3N5 — CID 87869334
4-chloro-2-piperidin-1-yl-7-(4,5,6-trifluoro-3-methyl-2-pyridinyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine (PubChem CID 87869334) has the molecular formula C19H21ClF3N5 and a molecular weight of 411.86 g/mol. Its IUPAC name is 4-chloro-2-piperidin-1-yl-7-(4,5,6-trifluoro-3-methyl-2-pyridinyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine.
| Compound Name | 4-chloro-2-piperidin-1-yl-7-(4,5,6-trifluoro-3-methyl-2-pyridinyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 87869334 |
| Molecular Formula | C19H21ClF3N5 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-chloro-2-piperidin-1-yl-7-(4,5,6-trifluoro-3-methyl-2-pyridinyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine |
| SMILES | Cc1c(N2CCc3nc(N4CCCCC4)nc(Cl)c3CC2)nc(F)c(F)c1F |
| InChI | InChI=1S/C19H21ClF3N5/c1-11-14(21)15(22)17(23)26-18(11)27-9-5-12-13(6-10-27)24-19(25-16(12)20)28-7-3-2-4-8-28/h2-10H2,1H3 |
| InChIKey | IJAGOFVCQWKIMN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|