C14H14ClF3N4S — CID 170554026
7-chloro-4-(3,3-difluoropiperidin-1-yl)-8-fluoro-5-methyl-2-methylsulfanylpyrido[4,3-d]pyrimidine (PubChem CID 170554026) has the molecular formula C14H14ClF3N4S and a molecular weight of 362.81 g/mol. Its IUPAC name is 7-chloro-4-(3,3-difluoropiperidin-1-yl)-8-fluoro-5-methyl-2-methylsulfanylpyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-(3,3-difluoropiperidin-1-yl)-8-fluoro-5-methyl-2-methylsulfanylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 170554026 |
| Molecular Formula | C14H14ClF3N4S |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 7-chloro-4-(3,3-difluoropiperidin-1-yl)-8-fluoro-5-methyl-2-methylsulfanylpyrido[4,3-d]pyrimidine |
| SMILES | CSc1nc(N2CCCC(F)(F)C2)c2c(C)nc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C14H14ClF3N4S/c1-7-8-10(9(16)11(15)19-7)20-13(23-2)21-12(8)22-5-3-4-14(17,18)6-22/h3-6H2,1-2H3 |
| InChIKey | LVEHXSWXGFJAHM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|