C19H26O5Si — CID 87871263
methyl 3-(1-cyclopropyl-1-trimethylsilylprop-2-ynoxy)-4,5-dimethoxybenzoate (PubChem CID 87871263) has the molecular formula C19H26O5Si and a molecular weight of 362.50 g/mol. Its IUPAC name is methyl 3-(1-cyclopropyl-1-trimethylsilylprop-2-ynoxy)-4,5-dimethoxybenzoate.
| Compound Name | methyl 3-(1-cyclopropyl-1-trimethylsilylprop-2-ynoxy)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 87871263 |
| Molecular Formula | C19H26O5Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | methyl 3-(1-cyclopropyl-1-trimethylsilylprop-2-ynoxy)-4,5-dimethoxybenzoate |
| SMILES | C#CC(Oc1cc(C(=O)OC)cc(OC)c1OC)(C1CC1)[Si](C)(C)C |
| InChI | InChI=1S/C19H26O5Si/c1-8-19(14-9-10-14,25(5,6)7)24-16-12-13(18(20)23-4)11-15(21-2)17(16)22-3/h1,11-12,14H,9-10H2,2-7H3 |
| InChIKey | BILSGUVIEYNIMD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|