3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid

C15H16O5 — CID 19074965

IUPAC3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid
SMILESC#CC(Oc1cc(C(=O)O)cc(OC)c1OC)C1CC1
InChIInChI=1S/C15H16O5/c1-4-11(9-5-6-9)20-13-8-10(15(16)17)7-12(18-2)14(13)19-3/h1,7-9,11H,5-6H2,2-3H3,(H,16,17)
InChIKeyUTHTZZHRGNZSDC-UHFFFAOYSA-N
MW276.29 g/mol
LogP2.19
Rot. Bonds6

About 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid

3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid (PubChem CID 19074965) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid.

Molecular Properties

Compound Name3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid
PubChem CID19074965
Molecular FormulaC15H16O5
Molecular Weight276.29 g/mol
Exact Mass276.10
IUPAC Name3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid
SMILESC#CC(Oc1cc(C(=O)O)cc(OC)c1OC)C1CC1
InChIInChI=1S/C15H16O5/c1-4-11(9-5-6-9)20-13-8-10(15(16)17)7-12(18-2)14(13)19-3/h1,7-9,11H,5-6H2,2-3H3,(H,16,17)
InChIKeyUTHTZZHRGNZSDC-UHFFFAOYSA-N
XLogP2.19
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid?
The IUPAC name of 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid (CID 19074965) is 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid.
What is the SMILES notation for 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid?
The canonical SMILES for 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid is C#CC(Oc1cc(C(=O)O)cc(OC)c1OC)C1CC1.
What is the InChIKey of 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid?
The InChIKey is UTHTZZHRGNZSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-4-11(9-5-6-9)20-13-8-10(15(16)17)7-12(18-2)14(13)19-3/h1,7-9,11H,5-6H2,2-3H3,(H,16,17).
What are the key properties of 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid?
3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid has a molecular weight of 276.29 g/mol, XLogP of 2.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-cyclopropylprop-2-ynoxy)-4,5-dimethoxybenzoic acid is sourced from PubChem (CID 19074965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).