C17H23NO8P2 — CID 87871951
[diethoxyphosphoryloxy-[4-(pyridin-2-ylmethoxy)phenyl]methyl]phosphonic acid (PubChem CID 87871951) has the molecular formula C17H23NO8P2 and a molecular weight of 431.32 g/mol. Its IUPAC name is [diethoxyphosphoryloxy-[4-(pyridin-2-ylmethoxy)phenyl]methyl]phosphonic acid.
| Compound Name | [diethoxyphosphoryloxy-[4-(pyridin-2-ylmethoxy)phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 87871951 |
| Molecular Formula | C17H23NO8P2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [diethoxyphosphoryloxy-[4-(pyridin-2-ylmethoxy)phenyl]methyl]phosphonic acid |
| SMILES | CCOP(=O)(OCC)OC(c1ccc(OCc2ccccn2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C17H23NO8P2/c1-3-24-28(22,25-4-2)26-17(27(19,20)21)14-8-10-16(11-9-14)23-13-15-7-5-6-12-18-15/h5-12,17H,3-4,13H2,1-2H3,(H2,19,20,21) |
| InChIKey | IVXOVXGVTIXNFF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|