C34H48N2 — CID 87875304
4-N-(2-but-3-ynylphenyl)-3-N-(3,5-dipentylphenyl)octane-3,4-diimine (PubChem CID 87875304) has the molecular formula C34H48N2 and a molecular weight of 484.77 g/mol. Its IUPAC name is 4-N-(2-but-3-ynylphenyl)-3-N-(3,5-dipentylphenyl)octane-3,4-diimine.
| Compound Name | 4-N-(2-but-3-ynylphenyl)-3-N-(3,5-dipentylphenyl)octane-3,4-diimine |
|---|---|
| PubChem CID | 87875304 |
| Molecular Formula | C34H48N2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | 4-N-(2-but-3-ynylphenyl)-3-N-(3,5-dipentylphenyl)octane-3,4-diimine |
| SMILES | C#CCCc1ccccc1/N=C(CCCC)/C(CC)=N/c1cc(CCCCC)cc(CCCCC)c1 |
| InChI | InChI=1S/C34H48N2/c1-6-11-15-19-28-25-29(20-16-12-7-2)27-31(26-28)35-32(10-5)34(23-14-9-4)36-33-24-18-17-22-30(33)21-13-8-3/h3,17-18,22,24-27H,6-7,9-16,19-21,23H2,1-2,4-5H3/b35-32+,36-34+ |
| InChIKey | BIGISBGERZHSFO-UPJNHMSQSA-N |
| XLogP | 10.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|