C34H39ClIN3O — CID 87876047
3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]-bis[(4-methylphenyl)methyl]azanium iodide (PubChem CID 87876047) has the molecular formula C34H39ClIN3O and a molecular weight of 668.06 g/mol. Its IUPAC name is 3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]-bis[(4-methylphenyl)methyl]azanium iodide.
| Compound Name | 3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]-bis[(4-methylphenyl)methyl]azanium iodide |
|---|---|
| PubChem CID | 87876047 |
| Molecular Formula | C34H39ClIN3O |
| Molecular Weight | 668.06 g/mol |
| Exact Mass | 667.18 |
| IUPAC Name | 3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]-bis[(4-methylphenyl)methyl]azanium iodide |
| SMILES | Cc1ccc(C[N+](CCCN(C(N)=O)c2ccccc2)(CCc2ccc(Cl)cc2)Cc2ccc(C)cc2)cc1.[I-] |
| InChI | InChI=1S/C34H38ClN3O.HI/c1-27-9-13-30(14-10-27)25-38(26-31-15-11-28(2)12-16-31,24-21-29-17-19-32(35)20-18-29)23-6-22-37(34(36)39)33-7-4-3-5-8-33;/h3-5,7-20H,6,21-26H2,1-2H3,(H-,36,39);1H |
| InChIKey | BXIGNSZAJNRLAX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.06 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|