C25H28Cl2IN3O — CID 173181065
1-[3-[2-(4-chlorophenyl)ethyl-[(2-chlorophenyl)methyl]amino]propyl]-1-phenylurea;hydroiodide (PubChem CID 173181065) has the molecular formula C25H28Cl2IN3O and a molecular weight of 584.33 g/mol. Its IUPAC name is 1-[3-[2-(4-chlorophenyl)ethyl-[(2-chlorophenyl)methyl]amino]propyl]-1-phenylurea;hydroiodide.
| Compound Name | 1-[3-[2-(4-chlorophenyl)ethyl-[(2-chlorophenyl)methyl]amino]propyl]-1-phenylurea;hydroiodide |
|---|---|
| PubChem CID | 173181065 |
| Molecular Formula | C25H28Cl2IN3O |
| Molecular Weight | 584.33 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 1-[3-[2-(4-chlorophenyl)ethyl-[(2-chlorophenyl)methyl]amino]propyl]-1-phenylurea;hydroiodide |
| SMILES | I.NC(=O)N(CCCN(CCc1ccc(Cl)cc1)Cc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H27Cl2N3O.HI/c26-22-13-11-20(12-14-22)15-18-29(19-21-7-4-5-10-24(21)27)16-6-17-30(25(28)31)23-8-2-1-3-9-23;/h1-5,7-14H,6,15-19H2,(H2,28,31);1H |
| InChIKey | QDBQDAKEARZWBQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.33 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|