C29H35ClIN3O3 — CID 173181184
methyl 4-[3-[3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]amino]propyl]benzoate;hydroiodide (PubChem CID 173181184) has the molecular formula C29H35ClIN3O3 and a molecular weight of 635.97 g/mol. Its IUPAC name is methyl 4-[3-[3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]amino]propyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[3-[3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]amino]propyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 173181184 |
| Molecular Formula | C29H35ClIN3O3 |
| Molecular Weight | 635.97 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | methyl 4-[3-[3-(N-carbamoylanilino)propyl-[2-(4-chlorophenyl)ethyl]amino]propyl]benzoate;hydroiodide |
| SMILES | COC(=O)c1ccc(CCCN(CCCN(C(N)=O)c2ccccc2)CCc2ccc(Cl)cc2)cc1.I |
| InChI | InChI=1S/C29H34ClN3O3.HI/c1-36-28(34)25-14-10-23(11-15-25)7-5-19-32(22-18-24-12-16-26(30)17-13-24)20-6-21-33(29(31)35)27-8-3-2-4-9-27;/h2-4,8-17H,5-7,18-22H2,1H3,(H2,31,35);1H |
| InChIKey | WFUGSDLFTVSEPK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.97 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|