C24H26Cl4N2 — CID 69254359
4-[2-[benzyl-[3-(4-chlorophenyl)propyl]amino]ethyl]-2,6-dichloroaniline;hydrochloride (PubChem CID 69254359) has the molecular formula C24H26Cl4N2 and a molecular weight of 484.30 g/mol. Its IUPAC name is 4-[2-[benzyl-[3-(4-chlorophenyl)propyl]amino]ethyl]-2,6-dichloroaniline;hydrochloride.
| Compound Name | 4-[2-[benzyl-[3-(4-chlorophenyl)propyl]amino]ethyl]-2,6-dichloroaniline;hydrochloride |
|---|---|
| PubChem CID | 69254359 |
| Molecular Formula | C24H26Cl4N2 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 4-[2-[benzyl-[3-(4-chlorophenyl)propyl]amino]ethyl]-2,6-dichloroaniline;hydrochloride |
| SMILES | Cl.Nc1c(Cl)cc(CCN(CCCc2ccc(Cl)cc2)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H25Cl3N2.ClH/c25-21-10-8-18(9-11-21)7-4-13-29(17-19-5-2-1-3-6-19)14-12-20-15-22(26)24(28)23(27)16-20;/h1-3,5-6,8-11,15-16H,4,7,12-14,17,28H2;1H |
| InChIKey | LBPYKWDSQHEOGQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|