C19H23Cl2FN2 — CID 160816080
2,6-dichloro-4-[2-[ethyl-[3-(4-fluorophenyl)propyl]amino]ethyl]aniline (PubChem CID 160816080) has the molecular formula C19H23Cl2FN2 and a molecular weight of 369.31 g/mol. Its IUPAC name is 2,6-dichloro-4-[2-[ethyl-[3-(4-fluorophenyl)propyl]amino]ethyl]aniline.
| Compound Name | 2,6-dichloro-4-[2-[ethyl-[3-(4-fluorophenyl)propyl]amino]ethyl]aniline |
|---|---|
| PubChem CID | 160816080 |
| Molecular Formula | C19H23Cl2FN2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2,6-dichloro-4-[2-[ethyl-[3-(4-fluorophenyl)propyl]amino]ethyl]aniline |
| SMILES | CCN(CCCc1ccc(F)cc1)CCc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl2FN2/c1-2-24(10-3-4-14-5-7-16(22)8-6-14)11-9-15-12-17(20)19(23)18(21)13-15/h5-8,12-13H,2-4,9-11,23H2,1H3 |
| InChIKey | SEXOWEBNEPYPJW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|