C21H29N3O3 — CID 87876845
benzyl N-[2-[cyano(3-methylbutyl)carbamoyl]cyclohexyl]carbamate (PubChem CID 87876845) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is benzyl N-[2-[cyano(3-methylbutyl)carbamoyl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[2-[cyano(3-methylbutyl)carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 87876845 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | benzyl N-[2-[cyano(3-methylbutyl)carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)CCN(C#N)C(=O)C1CCCCC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-16(2)12-13-24(15-22)20(25)18-10-6-7-11-19(18)23-21(26)27-14-17-8-4-3-5-9-17/h3-5,8-9,16,18-19H,6-7,10-14H2,1-2H3,(H,23,26) |
| InChIKey | FJAMSEGRINQSAJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|