About butan-2-yliminoniobium
butan-2-yliminoniobium (PubChem CID 87877810) has the molecular formula C4H9NNb
and a molecular weight of 164.03 g/mol. Its IUPAC name is butan-2-yliminoniobium.
Molecular Properties
| Compound Name | butan-2-yliminoniobium |
| PubChem CID | 87877810 |
| Molecular Formula | C4H9NNb |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | butan-2-yliminoniobium |
| SMILES | CCC(C)N=[Nb] |
| InChI | InChI=1S/C4H9N.Nb/c1-3-4(2)5;/h4H,3H2,1-2H3; |
| InChIKey | CIGJMLVVBSWLOM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-yliminoniobium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yliminoniobium?
The IUPAC name of butan-2-yliminoniobium (CID 87877810) is butan-2-yliminoniobium.
What is the SMILES notation for butan-2-yliminoniobium?
The canonical SMILES for butan-2-yliminoniobium is CCC(C)N=[Nb].
What is the InChIKey of butan-2-yliminoniobium?
The InChIKey is CIGJMLVVBSWLOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.Nb/c1-3-4(2)5;/h4H,3H2,1-2H3;.
What are the key properties of butan-2-yliminoniobium?
butan-2-yliminoniobium has a molecular weight of 164.03 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yliminoniobium is sourced from PubChem (CID 87877810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).