C37H51N5O8S — CID 87878352
ditert-butyl 2-[[4-[(2S)-3-methoxy-2-[[(2S)-1-(4-methylphenyl)sulfanylpyrrolidine-2-carbonyl]amino]-3-oxopropyl]phenyl]carbamoyl]piperazine-1,4-dicarboxylate (PubChem CID 87878352) has the molecular formula C37H51N5O8S and a molecular weight of 725.91 g/mol. Its IUPAC name is ditert-butyl 2-[[4-[(2S)-3-methoxy-2-[[(2S)-1-(4-methylphenyl)sulfanylpyrrolidine-2-carbonyl]amino]-3-oxopropyl]phenyl]carbamoyl]piperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-[[4-[(2S)-3-methoxy-2-[[(2S)-1-(4-methylphenyl)sulfanylpyrrolidine-2-carbonyl]amino]-3-oxopropyl]phenyl]carbamoyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 87878352 |
| Molecular Formula | C37H51N5O8S |
| Molecular Weight | 725.91 g/mol |
| Exact Mass | 725.35 |
| IUPAC Name | ditert-butyl 2-[[4-[(2S)-3-methoxy-2-[[(2S)-1-(4-methylphenyl)sulfanylpyrrolidine-2-carbonyl]amino]-3-oxopropyl]phenyl]carbamoyl]piperazine-1,4-dicarboxylate |
| SMILES | COC(=O)[C@H](Cc1ccc(NC(=O)C2CN(C(=O)OC(C)(C)C)CCN2C(=O)OC(C)(C)C)cc1)NC(=O)[C@@H]1CCCN1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C37H51N5O8S/c1-24-11-17-27(18-12-24)51-42-19-9-10-29(42)31(43)39-28(33(45)48-8)22-25-13-15-26(16-14-25)38-32(44)30-23-40(34(46)49-36(2,3)4)20-21-41(30)35(47)50-37(5,6)7/h11-18,28-30H,9-10,19-23H2,1-8H3,(H,38,44)(H,39,43)/t28-,29-,30?/m0/s1 |
| InChIKey | NRTXQDJLLFXNSH-ZTURCVLQSA-N |
| XLogP | 5.16 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|