C17H24FN4O3+ — CID 87884919
2-[1-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-2-hydroxy-5-oxopyrrolidin-1-ium-1-yl]acetamide (PubChem CID 87884919) has the molecular formula C17H24FN4O3+ and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[1-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-2-hydroxy-5-oxopyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | 2-[1-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-2-hydroxy-5-oxopyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 87884919 |
| Molecular Formula | C17H24FN4O3+ |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[1-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-2-hydroxy-5-oxopyrrolidin-1-ium-1-yl]acetamide |
| SMILES | CC1CN(c2ccc([N+]3(CC(N)=O)C(=O)CCC3O)cc2F)CCN1 |
| InChI | InChI=1S/C17H23FN4O3/c1-11-9-21(7-6-20-11)14-3-2-12(8-13(14)18)22(10-15(19)23)16(24)4-5-17(22)25/h2-3,8,11,16,20,24H,4-7,9-10H2,1H3,(H-,19,23)/p+1 |
| InChIKey | GSUQQXOVHNWMBS-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|