C22H19N5O2 — CID 87885359
ethyl 2-(benzhydrylideneamino)-2-(7H-purin-2-yl)acetate (PubChem CID 87885359) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-2-(7H-purin-2-yl)acetate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-2-(7H-purin-2-yl)acetate |
|---|---|
| PubChem CID | 87885359 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-2-(7H-purin-2-yl)acetate |
| SMILES | CCOC(=O)C(N=C(c1ccccc1)c1ccccc1)c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C22H19N5O2/c1-2-29-22(28)19(21-23-13-17-20(27-21)25-14-24-17)26-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,19H,2H2,1H3,(H,23,24,25,27) |
| InChIKey | MHQLAVNKANISGT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|