C16H12ClF7N2O2 — CID 87885396
2-chloropyridine-4-carboxylic acid;4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylaniline (PubChem CID 87885396) has the molecular formula C16H12ClF7N2O2 and a molecular weight of 432.72 g/mol. Its IUPAC name is 2-chloropyridine-4-carboxylic acid;4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylaniline.
| Compound Name | 2-chloropyridine-4-carboxylic acid;4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylaniline |
|---|---|
| PubChem CID | 87885396 |
| Molecular Formula | C16H12ClF7N2O2 |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-chloropyridine-4-carboxylic acid;4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylaniline |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)F)ccc1N.O=C(O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H8F7N.C6H4ClNO2/c1-5-4-6(2-3-7(5)18)8(11,12)9(13,14)10(15,16)17;7-5-3-4(6(9)10)1-2-8-5/h2-4H,18H2,1H3;1-3H,(H,9,10) |
| InChIKey | SIYMYSFYYZIDGV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|