C8H9N3O — CID 87888728
N-(cyanomethyl)-2,3-dihydropyridine-3-carboxamide (PubChem CID 87888728) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is N-(cyanomethyl)-2,3-dihydropyridine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-2,3-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 87888728 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | N-(cyanomethyl)-2,3-dihydropyridine-3-carboxamide |
| SMILES | N#CCNC(=O)C1C=CC=NC1 |
| InChI | InChI=1S/C8H9N3O/c9-3-5-11-8(12)7-2-1-4-10-6-7/h1-2,4,7H,5-6H2,(H,11,12) |
| InChIKey | LCRVTBCFUQAZNH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|