C8H12N2O — CID 91444132
N-ethyl-2,5-dihydropyridine-5-carboxamide (PubChem CID 91444132) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is N-ethyl-2,5-dihydropyridine-5-carboxamide.
| Compound Name | N-ethyl-2,5-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 91444132 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-ethyl-2,5-dihydropyridine-5-carboxamide |
| SMILES | CCNC(=O)C1C=CCN=C1 |
| InChI | InChI=1S/C8H12N2O/c1-2-10-8(11)7-4-3-5-9-6-7/h3-4,6-7H,2,5H2,1H3,(H,10,11) |
| InChIKey | NVKKBOHJMBIGKT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|