C16H14Cl3N3O4S2 — CID 87892755
[(1S)-3-(2-chloro-4-sulfamoylanilino)-1-(2,3-dichlorophenyl)-3-oxopropyl]carbamothioic S-acid (PubChem CID 87892755) has the molecular formula C16H14Cl3N3O4S2 and a molecular weight of 482.80 g/mol. Its IUPAC name is [(1S)-3-(2-chloro-4-sulfamoylanilino)-1-(2,3-dichlorophenyl)-3-oxopropyl]carbamothioic S-acid.
| Compound Name | [(1S)-3-(2-chloro-4-sulfamoylanilino)-1-(2,3-dichlorophenyl)-3-oxopropyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 87892755 |
| Molecular Formula | C16H14Cl3N3O4S2 |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | [(1S)-3-(2-chloro-4-sulfamoylanilino)-1-(2,3-dichlorophenyl)-3-oxopropyl]carbamothioic S-acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C[C@H](NC(=O)S)c2cccc(Cl)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl3N3O4S2/c17-10-3-1-2-9(15(10)19)13(22-16(24)27)7-14(23)21-12-5-4-8(6-11(12)18)28(20,25)26/h1-6,13H,7H2,(H,21,23)(H2,20,25,26)(H2,22,24,27)/t13-/m0/s1 |
| InChIKey | YPPNAWKJVUOFRR-ZDUSSCGKSA-N |
| XLogP | 4.00 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|