C16H17ClN4O4S — CID 8008810
(3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-(3-sulfamoylphenyl)propanamide (PubChem CID 8008810) has the molecular formula C16H17ClN4O4S and a molecular weight of 396.86 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 8008810 |
| Molecular Formula | C16H17ClN4O4S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-(3-sulfamoylphenyl)propanamide |
| SMILES | NC(=O)N[C@H](CC(=O)Nc1cccc(S(N)(=O)=O)c1)c1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN4O4S/c17-13-7-2-1-6-12(13)14(21-16(18)23)9-15(22)20-10-4-3-5-11(8-10)26(19,24)25/h1-8,14H,9H2,(H,20,22)(H3,18,21,23)(H2,19,24,25)/t14-/m1/s1 |
| InChIKey | DBYNOQLIXUKHCM-CQSZACIVSA-N |
| XLogP | 1.73 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |