C7H9IO — CID 87894089
(1S)-1-(2-iodocyclopenta-2,4-dien-1-yl)ethanol (PubChem CID 87894089) has the molecular formula C7H9IO and a molecular weight of 236.05 g/mol. Its IUPAC name is (1S)-1-(2-iodocyclopenta-2,4-dien-1-yl)ethanol.
| Compound Name | (1S)-1-(2-iodocyclopenta-2,4-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 87894089 |
| Molecular Formula | C7H9IO |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | (1S)-1-(2-iodocyclopenta-2,4-dien-1-yl)ethanol |
| SMILES | C[C@H](O)C1C=CC=C1I |
| InChI | InChI=1S/C7H9IO/c1-5(9)6-3-2-4-7(6)8/h2-6,9H,1H3/t5-,6?/m0/s1 |
| InChIKey | PSVLSFIQAOEWQK-ZBHICJROSA-N |
| XLogP | 1.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|