C26H44N4O4 — CID 87895069
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;icosa-2,4,6,8,10-pentaenoic acid (PubChem CID 87895069) has the molecular formula C26H44N4O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;icosa-2,4,6,8,10-pentaenoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;icosa-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 87895069 |
| Molecular Formula | C26H44N4O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;icosa-2,4,6,8,10-pentaenoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC(=O)O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H30O2.C6H14N4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;7-4(5(11)12)2-1-3-10-6(8)9/h10-19H,2-9H2,1H3,(H,21,22);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | XLPADVSHIIMXJI-VWMHFEHESA-N |
| XLogP | 4.44 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|