C12H10N2O4 — CID 87898509
(2S)-2-formamido-2-(1-oxo-2H-isoquinolin-3-yl)acetic acid (PubChem CID 87898509) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is (2S)-2-formamido-2-(1-oxo-2H-isoquinolin-3-yl)acetic acid.
| Compound Name | (2S)-2-formamido-2-(1-oxo-2H-isoquinolin-3-yl)acetic acid |
|---|---|
| PubChem CID | 87898509 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (2S)-2-formamido-2-(1-oxo-2H-isoquinolin-3-yl)acetic acid |
| SMILES | O=CN[C@H](C(=O)O)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N2O4/c15-6-13-10(12(17)18)9-5-7-3-1-2-4-8(7)11(16)14-9/h1-6,10H,(H,13,15)(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | KHKNJKVHWOKRMM-JTQLQIEISA-N |
| XLogP | 0.40 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|