C15H12N2O3S — CID 115284483
2-[(1-oxo-2H-isoquinolin-3-yl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 115284483) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[(1-oxo-2H-isoquinolin-3-yl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(1-oxo-2H-isoquinolin-3-yl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115284483 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[(1-oxo-2H-isoquinolin-3-yl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | O=C(O)C(Nc1cc2ccccc2c(=O)[nH]1)c1cccs1 |
| InChI | InChI=1S/C15H12N2O3S/c18-14-10-5-2-1-4-9(10)8-12(17-14)16-13(15(19)20)11-6-3-7-21-11/h1-8,13H,(H,19,20)(H2,16,17,18) |
| InChIKey | FMOWJKJPLOYJAZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |