C13H10N2O2S2 — CID 113278699
2-(2,1-benzothiazol-3-ylamino)-2-thiophen-2-ylacetic acid (PubChem CID 113278699) has the molecular formula C13H10N2O2S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(2,1-benzothiazol-3-ylamino)-2-thiophen-2-ylacetic acid.
| Compound Name | 2-(2,1-benzothiazol-3-ylamino)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 113278699 |
| Molecular Formula | C13H10N2O2S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-(2,1-benzothiazol-3-ylamino)-2-thiophen-2-ylacetic acid |
| SMILES | O=C(O)C(Nc1snc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C13H10N2O2S2/c16-13(17)11(10-6-3-7-18-10)14-12-8-4-1-2-5-9(8)15-19-12/h1-7,11,14H,(H,16,17) |
| InChIKey | MQWIIBWZLUCMKU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |