C15H18N4O3S — CID 87901933
3-[(1-amino-2-phenylethyl)-hydroxysulfamoyl]benzenecarboximidamide (PubChem CID 87901933) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 3-[(1-amino-2-phenylethyl)-hydroxysulfamoyl]benzenecarboximidamide.
| Compound Name | 3-[(1-amino-2-phenylethyl)-hydroxysulfamoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 87901933 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-[(1-amino-2-phenylethyl)-hydroxysulfamoyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(S(=O)(=O)N(O)C(N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H18N4O3S/c16-14(9-11-5-2-1-3-6-11)19(20)23(21,22)13-8-4-7-12(10-13)15(17)18/h1-8,10,14,20H,9,16H2,(H3,17,18) |
| InChIKey | QDANZJIVPWYIQZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|