C21H22N6O5S2 — CID 91539665
1-[4-[benzyl(sulfamoyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea (PubChem CID 91539665) has the molecular formula C21H22N6O5S2 and a molecular weight of 502.58 g/mol. Its IUPAC name is 1-[4-[benzyl(sulfamoyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea.
| Compound Name | 1-[4-[benzyl(sulfamoyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea |
|---|---|
| PubChem CID | 91539665 |
| Molecular Formula | C21H22N6O5S2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 1-[4-[benzyl(sulfamoyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea |
| SMILES | [H]/N=C(\N)c1cccc(NC(=O)Nc2ccc(S(=O)(=O)N(Cc3ccccc3)S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C21H22N6O5S2/c22-20(23)16-7-4-8-18(13-16)26-21(28)25-17-9-11-19(12-10-17)33(29,30)27(34(24,31)32)14-15-5-2-1-3-6-15/h1-13H,14H2,(H3,22,23)(H2,24,31,32)(H2,25,26,28) |
| InChIKey | HSDOHNDIDVTPHP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 188.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|