C22H20F3N5O3S — CID 91369220
1-[4-[benzyl(trifluoromethyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea (PubChem CID 91369220) has the molecular formula C22H20F3N5O3S and a molecular weight of 491.50 g/mol. Its IUPAC name is 1-[4-[benzyl(trifluoromethyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea.
| Compound Name | 1-[4-[benzyl(trifluoromethyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea |
|---|---|
| PubChem CID | 91369220 |
| Molecular Formula | C22H20F3N5O3S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[4-[benzyl(trifluoromethyl)sulfamoyl]phenyl]-3-(3-carbamimidoylphenyl)urea |
| SMILES | [H]/N=C(\N)c1cccc(NC(=O)Nc2ccc(S(=O)(=O)N(Cc3ccccc3)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H20F3N5O3S/c23-22(24,25)30(14-15-5-2-1-3-6-15)34(32,33)19-11-9-17(10-12-19)28-21(31)29-18-8-4-7-16(13-18)20(26)27/h1-13H,14H2,(H3,26,27)(H2,28,29,31) |
| InChIKey | WTGBDOXLXKJAJK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|