C20H22F3N5O4S — CID 10140917
N'-[(3-carbamimidoylphenyl)methyl]-N-[3-(methanesulfonamidomethyl)phenyl]-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 10140917) has the molecular formula C20H22F3N5O4S and a molecular weight of 485.49 g/mol. Its IUPAC name is N'-[(3-carbamimidoylphenyl)methyl]-N-[3-(methanesulfonamidomethyl)phenyl]-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N'-[(3-carbamimidoylphenyl)methyl]-N-[3-(methanesulfonamidomethyl)phenyl]-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 10140917 |
| Molecular Formula | C20H22F3N5O4S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N'-[(3-carbamimidoylphenyl)methyl]-N-[3-(methanesulfonamidomethyl)phenyl]-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | [H]/N=C(\N)c1cccc(CN(CC(F)(F)F)C(=O)C(=O)Nc2cccc(CNS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C20H22F3N5O4S/c1-33(31,32)26-10-13-4-3-7-16(9-13)27-18(29)19(30)28(12-20(21,22)23)11-14-5-2-6-15(8-14)17(24)25/h2-9,26H,10-12H2,1H3,(H3,24,25)(H,27,29) |
| InChIKey | YRTFARNJFBWHAV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|