C24H25F3N4O3 — CID 10116333
N-[(3-carbamimidoylphenyl)methyl]-2-oxo-2-(2-oxo-4-phenylazepan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 10116333) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-[(3-carbamimidoylphenyl)methyl]-2-oxo-2-(2-oxo-4-phenylazepan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-[(3-carbamimidoylphenyl)methyl]-2-oxo-2-(2-oxo-4-phenylazepan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 10116333 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[(3-carbamimidoylphenyl)methyl]-2-oxo-2-(2-oxo-4-phenylazepan-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\N)c1cccc(CN(CC(F)(F)F)C(=O)C(=O)N2CCCC(c3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C24H25F3N4O3/c25-24(26,27)15-30(14-16-6-4-9-19(12-16)21(28)29)22(33)23(34)31-11-5-10-18(13-20(31)32)17-7-2-1-3-8-17/h1-4,6-9,12,18H,5,10-11,13-15H2,(H3,28,29) |
| InChIKey | UQRLSPMGHQIUBX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|