About ethanol;1-iodoprop-2-ynyl hydrogen carbonate
ethanol;1-iodoprop-2-ynyl hydrogen carbonate (PubChem CID 87902941) has the molecular formula C6H9IO4
and a molecular weight of 272.04 g/mol. Its IUPAC name is ethanol;1-iodoprop-2-ynyl hydrogen carbonate.
Molecular Properties
| Compound Name | ethanol;1-iodoprop-2-ynyl hydrogen carbonate |
| PubChem CID | 87902941 |
| Molecular Formula | C6H9IO4 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | ethanol;1-iodoprop-2-ynyl hydrogen carbonate |
| SMILES | C#CC(I)OC(=O)O.CCO |
| InChI | InChI=1S/C4H3IO3.C2H6O/c1-2-3(5)8-4(6)7;1-2-3/h1,3H,(H,6,7);3H,2H2,1H3 |
| InChIKey | OJZAWCJJILCGHZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;1-iodoprop-2-ynyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-iodoprop-2-ynyl hydrogen carbonate?
The IUPAC name of ethanol;1-iodoprop-2-ynyl hydrogen carbonate (CID 87902941) is ethanol;1-iodoprop-2-ynyl hydrogen carbonate.
What is the SMILES notation for ethanol;1-iodoprop-2-ynyl hydrogen carbonate?
The canonical SMILES for ethanol;1-iodoprop-2-ynyl hydrogen carbonate is C#CC(I)OC(=O)O.CCO.
What is the InChIKey of ethanol;1-iodoprop-2-ynyl hydrogen carbonate?
The InChIKey is OJZAWCJJILCGHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3IO3.C2H6O/c1-2-3(5)8-4(6)7;1-2-3/h1,3H,(H,6,7);3H,2H2,1H3.
What are the key properties of ethanol;1-iodoprop-2-ynyl hydrogen carbonate?
ethanol;1-iodoprop-2-ynyl hydrogen carbonate has a molecular weight of 272.04 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-iodoprop-2-ynyl hydrogen carbonate is sourced from PubChem (CID 87902941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).