C14H4Cl4I2O4 — CID 57085616
bis(1-iodoprop-2-ynyl) 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate (PubChem CID 57085616) has the molecular formula C14H4Cl4I2O4 and a molecular weight of 631.80 g/mol. Its IUPAC name is bis(1-iodoprop-2-ynyl) 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate.
| Compound Name | bis(1-iodoprop-2-ynyl) 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57085616 |
| Molecular Formula | C14H4Cl4I2O4 |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 629.70 |
| IUPAC Name | bis(1-iodoprop-2-ynyl) 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate |
| SMILES | C#CC(I)OC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)OC(I)C#C |
| InChI | InChI=1S/C14H4Cl4I2O4/c1-3-5(19)23-13(21)7-8(14(22)24-6(20)4-2)10(16)12(18)11(17)9(7)15/h1-2,5-6H |
| InChIKey | NBNBIKBZTGOHFM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|