C11H5Cl2IN2O6 — CID 88668567
1-iodoprop-2-ynyl 2-chloro-2-(4-chloro-3,5-dinitrophenyl)acetate (PubChem CID 88668567) has the molecular formula C11H5Cl2IN2O6 and a molecular weight of 458.98 g/mol. Its IUPAC name is 1-iodoprop-2-ynyl 2-chloro-2-(4-chloro-3,5-dinitrophenyl)acetate.
| Compound Name | 1-iodoprop-2-ynyl 2-chloro-2-(4-chloro-3,5-dinitrophenyl)acetate |
|---|---|
| PubChem CID | 88668567 |
| Molecular Formula | C11H5Cl2IN2O6 |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 457.86 |
| IUPAC Name | 1-iodoprop-2-ynyl 2-chloro-2-(4-chloro-3,5-dinitrophenyl)acetate |
| SMILES | C#CC(I)OC(=O)C(Cl)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H5Cl2IN2O6/c1-2-8(14)22-11(17)9(12)5-3-6(15(18)19)10(13)7(4-5)16(20)21/h1,3-4,8-9H |
| InChIKey | KTJMAWMAMONSDB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|