C30H44N2Ni — CID 87910762
5-N,6-N-bis(3,4-dimethylphenyl)tetradecane-5,6-diimine;nickel (PubChem CID 87910762) has the molecular formula C30H44N2Ni and a molecular weight of 491.39 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-dimethylphenyl)tetradecane-5,6-diimine;nickel.
| Compound Name | 5-N,6-N-bis(3,4-dimethylphenyl)tetradecane-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87910762 |
| Molecular Formula | C30H44N2Ni |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 5-N,6-N-bis(3,4-dimethylphenyl)tetradecane-5,6-diimine;nickel |
| SMILES | CCCCCCCCC(=N\c1ccc(C)c(C)c1)/C(CCCC)=N/c1ccc(C)c(C)c1.[Ni] |
| InChI | InChI=1S/C30H44N2.Ni/c1-7-9-11-12-13-14-16-30(32-28-20-18-24(4)26(6)22-28)29(15-10-8-2)31-27-19-17-23(3)25(5)21-27;/h17-22H,7-16H2,1-6H3;/b31-29+,32-30+; |
| InChIKey | FXDBVQAWMKNFMA-JPGNHJAOSA-N |
| XLogP | 9.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|