C29H38N2Ni — CID 87910947
2-N,3-N-bis[2-[(E)-pent-3-enyl]phenyl]heptane-2,3-diimine;nickel (PubChem CID 87910947) has the molecular formula C29H38N2Ni and a molecular weight of 473.33 g/mol. Its IUPAC name is 2-N,3-N-bis[2-[(E)-pent-3-enyl]phenyl]heptane-2,3-diimine;nickel.
| Compound Name | 2-N,3-N-bis[2-[(E)-pent-3-enyl]phenyl]heptane-2,3-diimine;nickel |
|---|---|
| PubChem CID | 87910947 |
| Molecular Formula | C29H38N2Ni |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-N,3-N-bis[2-[(E)-pent-3-enyl]phenyl]heptane-2,3-diimine;nickel |
| SMILES | C/C=C/CCc1ccccc1/N=C(C)/C(CCCC)=N/c1ccccc1CC/C=C/C.[Ni] |
| InChI | InChI=1S/C29H38N2.Ni/c1-5-8-11-17-25-19-13-15-22-28(25)30-24(4)27(21-10-7-3)31-29-23-16-14-20-26(29)18-12-9-6-2;/h5-6,8-9,13-16,19-20,22-23H,7,10-12,17-18,21H2,1-4H3;/b8-5+,9-6+,30-24+,31-27+; |
| InChIKey | ASNSTDZBTWYTHZ-PTBAIKMXSA-N |
| XLogP | 8.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|