C22H27N7O2 — CID 87915542
N-[(3R)-3-amino-1-[3-[12-methyl-8-(methylamino)-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]phenyl]hexyl]formamide (PubChem CID 87915542) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is N-[(3R)-3-amino-1-[3-[12-methyl-8-(methylamino)-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]phenyl]hexyl]formamide.
| Compound Name | N-[(3R)-3-amino-1-[3-[12-methyl-8-(methylamino)-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]phenyl]hexyl]formamide |
|---|---|
| PubChem CID | 87915542 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[(3R)-3-amino-1-[3-[12-methyl-8-(methylamino)-5-oxa-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]phenyl]hexyl]formamide |
| SMILES | CCC[C@@H](N)CC(NC=O)c1cccc(-c2nc3c(nc(NC)c4ncn(C)c43)o2)c1 |
| InChI | InChI=1S/C22H27N7O2/c1-4-6-15(23)10-16(26-12-30)13-7-5-8-14(9-13)21-27-18-19-17(25-11-29(19)3)20(24-2)28-22(18)31-21/h5,7-9,11-12,15-16H,4,6,10,23H2,1-3H3,(H,24,28)(H,26,30)/t15-,16?/m1/s1 |
| InChIKey | XUQAWYKGJZTEGC-AAFJCEBUSA-N |
| XLogP | 3.12 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|