C30H31N3O6 — CID 87916106
ethyl (3S)-1-[3-(N-formyl-4-methylanilino)-5-[4-(hydroxycarbamoyl)phenyl]benzoyl]piperidine-3-carboxylate (PubChem CID 87916106) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is ethyl (3S)-1-[3-(N-formyl-4-methylanilino)-5-[4-(hydroxycarbamoyl)phenyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[3-(N-formyl-4-methylanilino)-5-[4-(hydroxycarbamoyl)phenyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 87916106 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | ethyl (3S)-1-[3-(N-formyl-4-methylanilino)-5-[4-(hydroxycarbamoyl)phenyl]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(-c3ccc(C(=O)NO)cc3)cc(N(C=O)c3ccc(C)cc3)c2)C1 |
| InChI | InChI=1S/C30H31N3O6/c1-3-39-30(37)23-5-4-14-32(18-23)29(36)25-15-24(21-8-10-22(11-9-21)28(35)31-38)16-27(17-25)33(19-34)26-12-6-20(2)7-13-26/h6-13,15-17,19,23,38H,3-5,14,18H2,1-2H3,(H,31,35)/t23-/m0/s1 |
| InChIKey | UCYANEIPCKQPOF-QHCPKHFHSA-N |
| XLogP | 4.49 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|