C29H29N3O6 — CID 87916116
methyl 1-[3-[4-(hydroxycarbamoyl)phenyl]-5-[(4-methylbenzoyl)amino]benzoyl]piperidine-3-carboxylate (PubChem CID 87916116) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is methyl 1-[3-[4-(hydroxycarbamoyl)phenyl]-5-[(4-methylbenzoyl)amino]benzoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[3-[4-(hydroxycarbamoyl)phenyl]-5-[(4-methylbenzoyl)amino]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 87916116 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | methyl 1-[3-[4-(hydroxycarbamoyl)phenyl]-5-[(4-methylbenzoyl)amino]benzoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)c2cc(NC(=O)c3ccc(C)cc3)cc(-c3ccc(C(=O)NO)cc3)c2)C1 |
| InChI | InChI=1S/C29H29N3O6/c1-18-5-7-20(8-6-18)26(33)30-25-15-23(19-9-11-21(12-10-19)27(34)31-37)14-24(16-25)28(35)32-13-3-4-22(17-32)29(36)38-2/h5-12,14-16,22,37H,3-4,13,17H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | FDUCEJDTUYMFSM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|