C24H54NO4P — CID 87917867
phosphoric acid;5-propyl-N-(5-propylnonan-5-yl)nonan-5-amine (PubChem CID 87917867) has the molecular formula C24H54NO4P and a molecular weight of 451.67 g/mol. Its IUPAC name is phosphoric acid;5-propyl-N-(5-propylnonan-5-yl)nonan-5-amine.
| Compound Name | phosphoric acid;5-propyl-N-(5-propylnonan-5-yl)nonan-5-amine |
|---|---|
| PubChem CID | 87917867 |
| Molecular Formula | C24H54NO4P |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | phosphoric acid;5-propyl-N-(5-propylnonan-5-yl)nonan-5-amine |
| SMILES | CCCCC(CCC)(CCCC)NC(CCC)(CCCC)CCCC.O=P(O)(O)O |
| InChI | InChI=1S/C24H51N.H3O4P/c1-7-13-19-23(17-11-5,20-14-8-2)25-24(18-12-6,21-15-9-3)22-16-10-4;1-5(2,3)4/h25H,7-22H2,1-6H3;(H3,1,2,3,4) |
| InChIKey | PUHSURTVLKBAHN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|