C25H30N4O7S — CID 87919432
(4-cyanophenoxy)-[1-[3-(3,4-dimethoxyphenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-2-yl]carbamic acid (PubChem CID 87919432) has the molecular formula C25H30N4O7S and a molecular weight of 530.60 g/mol. Its IUPAC name is (4-cyanophenoxy)-[1-[3-(3,4-dimethoxyphenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-2-yl]carbamic acid.
| Compound Name | (4-cyanophenoxy)-[1-[3-(3,4-dimethoxyphenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87919432 |
| Molecular Formula | C25H30N4O7S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (4-cyanophenoxy)-[1-[3-(3,4-dimethoxyphenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-2-yl]carbamic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CC3CCC(C2)N3CC(C)N(Oc2ccc(C#N)cc2)C(=O)O)cc1OC |
| InChI | InChI=1S/C25H30N4O7S/c1-17(29(25(30)31)36-21-8-4-18(13-26)5-9-21)14-28-19-6-7-20(28)16-27(15-19)37(32,33)22-10-11-23(34-2)24(12-22)35-3/h4-5,8-12,17,19-20H,6-7,14-16H2,1-3H3,(H,30,31) |
| InChIKey | MWURFUVDTXZIJV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|